C12H19N3O — CID 61148599
(2S,3S)-2-amino-3-methyl-N-(4-methyl-2-pyridinyl)pentanamide (PubChem CID 61148599) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methyl-N-(4-methyl-2-pyridinyl)pentanamide.
| Compound Name | (2S,3S)-2-amino-3-methyl-N-(4-methyl-2-pyridinyl)pentanamide |
|---|---|
| PubChem CID | 61148599 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | (2S,3S)-2-amino-3-methyl-N-(4-methyl-2-pyridinyl)pentanamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)Nc1cc(C)ccn1 |
| InChI | InChI=1S/C12H19N3O/c1-4-9(3)11(13)12(16)15-10-7-8(2)5-6-14-10/h5-7,9,11H,4,13H2,1-3H3,(H,14,15,16)/t9-,11-/m0/s1 |
| InChIKey | UJZIFVCQCQSERO-ONGXEEELSA-N |
| XLogP | 1.70 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |