C13H14FN3O3 — CID 139791759
(2-amino-6-fluorophenyl)-(4,6-dimethoxypyrimidin-2-yl)methanol (PubChem CID 139791759) has the molecular formula C13H14FN3O3 and a molecular weight of 279.27 g/mol. Its IUPAC name is (2-amino-6-fluorophenyl)-(4,6-dimethoxypyrimidin-2-yl)methanol.
| Compound Name | (2-amino-6-fluorophenyl)-(4,6-dimethoxypyrimidin-2-yl)methanol |
|---|---|
| PubChem CID | 139791759 |
| Molecular Formula | C13H14FN3O3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (2-amino-6-fluorophenyl)-(4,6-dimethoxypyrimidin-2-yl)methanol |
| SMILES | COc1cc(OC)nc(C(O)c2c(N)cccc2F)n1 |
| InChI | InChI=1S/C13H14FN3O3/c1-19-9-6-10(20-2)17-13(16-9)12(18)11-7(14)4-3-5-8(11)15/h3-6,12,18H,15H2,1-2H3 |
| InChIKey | RUKGVJKONKNDBU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|