C13H12F3N3O2 — CID 67350155
6-[(4,6-dimethoxypyrimidin-2-yl)-fluoromethyl]-2,3-difluoroaniline (PubChem CID 67350155) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is 6-[(4,6-dimethoxypyrimidin-2-yl)-fluoromethyl]-2,3-difluoroaniline.
| Compound Name | 6-[(4,6-dimethoxypyrimidin-2-yl)-fluoromethyl]-2,3-difluoroaniline |
|---|---|
| PubChem CID | 67350155 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 6-[(4,6-dimethoxypyrimidin-2-yl)-fluoromethyl]-2,3-difluoroaniline |
| SMILES | COc1cc(OC)nc(C(F)c2ccc(F)c(F)c2N)n1 |
| InChI | InChI=1S/C13H12F3N3O2/c1-20-8-5-9(21-2)19-13(18-8)10(15)6-3-4-7(14)11(16)12(6)17/h3-5,10H,17H2,1-2H3 |
| InChIKey | XDOWMVMDKXNPRQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|