C14H15ClFN3O2S — CID 67350392
2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)-methylsulfanylmethyl]-3-fluoroaniline (PubChem CID 67350392) has the molecular formula C14H15ClFN3O2S and a molecular weight of 343.81 g/mol. Its IUPAC name is 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)-methylsulfanylmethyl]-3-fluoroaniline.
| Compound Name | 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)-methylsulfanylmethyl]-3-fluoroaniline |
|---|---|
| PubChem CID | 67350392 |
| Molecular Formula | C14H15ClFN3O2S |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)-methylsulfanylmethyl]-3-fluoroaniline |
| SMILES | COc1cc(OC)nc(C(SC)c2ccc(F)c(Cl)c2N)n1 |
| InChI | InChI=1S/C14H15ClFN3O2S/c1-20-9-6-10(21-2)19-14(18-9)13(22-3)7-4-5-8(16)11(15)12(7)17/h4-6,13H,17H2,1-3H3 |
| InChIKey | BSRIKXXEQYMEOU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|