C14H12ClF3N2OS — CID 141131391
2-[(3-chlorophenyl)-methylsulfanylmethyl]-4-methoxy-6-(trifluoromethyl)pyrimidine (PubChem CID 141131391) has the molecular formula C14H12ClF3N2OS and a molecular weight of 348.78 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)-methylsulfanylmethyl]-4-methoxy-6-(trifluoromethyl)pyrimidine.
| Compound Name | 2-[(3-chlorophenyl)-methylsulfanylmethyl]-4-methoxy-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 141131391 |
| Molecular Formula | C14H12ClF3N2OS |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-[(3-chlorophenyl)-methylsulfanylmethyl]-4-methoxy-6-(trifluoromethyl)pyrimidine |
| SMILES | COc1cc(C(F)(F)F)nc(C(SC)c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C14H12ClF3N2OS/c1-21-11-7-10(14(16,17)18)19-13(20-11)12(22-2)8-4-3-5-9(15)6-8/h3-7,12H,1-2H3 |
| InChIKey | QNFKJYJUYOTTHL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |