C11H16F3N3O — CID 82666594
1-[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]-3-methylbutan-1-amine (PubChem CID 82666594) has the molecular formula C11H16F3N3O and a molecular weight of 263.26 g/mol. Its IUPAC name is 1-[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]-3-methylbutan-1-amine.
| Compound Name | 1-[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 82666594 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1-[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]-3-methylbutan-1-amine |
| SMILES | COc1cc(C(F)(F)F)nc(C(N)CC(C)C)n1 |
| InChI | InChI=1S/C11H16F3N3O/c1-6(2)4-7(15)10-16-8(11(12,13)14)5-9(17-10)18-3/h5-7H,4,15H2,1-3H3 |
| InChIKey | IEMKFOBFZJBWQG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |