C12H17F3N2O — CID 153376648
2-[2-methoxy-6-(trifluoromethyl)-4-pyridinyl]-N-methylbutan-1-amine (PubChem CID 153376648) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-[2-methoxy-6-(trifluoromethyl)-4-pyridinyl]-N-methylbutan-1-amine.
| Compound Name | 2-[2-methoxy-6-(trifluoromethyl)-4-pyridinyl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 153376648 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-[2-methoxy-6-(trifluoromethyl)-4-pyridinyl]-N-methylbutan-1-amine |
| SMILES | CCC(CNC)c1cc(OC)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H17F3N2O/c1-4-8(7-16-2)9-5-10(12(13,14)15)17-11(6-9)18-3/h5-6,8,16H,4,7H2,1-3H3 |
| InChIKey | RHPNKBYAGJNYTO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |