C13H22N2O — CID 116946443
2-ethyl-1-(4-methoxyphenyl)-N'-methylpropane-1,3-diamine (PubChem CID 116946443) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-ethyl-1-(4-methoxyphenyl)-N'-methylpropane-1,3-diamine.
| Compound Name | 2-ethyl-1-(4-methoxyphenyl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 116946443 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-ethyl-1-(4-methoxyphenyl)-N'-methylpropane-1,3-diamine |
| SMILES | CCC(CNC)C(N)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H22N2O/c1-4-10(9-15-2)13(14)11-5-7-12(16-3)8-6-11/h5-8,10,13,15H,4,9,14H2,1-3H3 |
| InChIKey | BXKUCZDPYAFKET-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |