C11H18N2O — CID 163535290
(1S,2R)-1-(4-methoxyphenyl)-2-N-methylpropane-1,2-diamine (PubChem CID 163535290) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (1S,2R)-1-(4-methoxyphenyl)-2-N-methylpropane-1,2-diamine.
| Compound Name | (1S,2R)-1-(4-methoxyphenyl)-2-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 163535290 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (1S,2R)-1-(4-methoxyphenyl)-2-N-methylpropane-1,2-diamine |
| SMILES | CN[C@H](C)[C@@H](N)c1ccc(OC)cc1 |
| InChI | InChI=1S/C11H18N2O/c1-8(13-2)11(12)9-4-6-10(14-3)7-5-9/h4-8,11,13H,12H2,1-3H3/t8-,11-/m1/s1 |
| InChIKey | DWKPZVKTYHOCBR-LDYMZIIASA-N |
| XLogP | 1.30 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |