C13H21NO — CID 81016213
3-(4-methoxyphenyl)-N,2-dimethylbutan-1-amine (PubChem CID 81016213) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N,2-dimethylbutan-1-amine.
| Compound Name | 3-(4-methoxyphenyl)-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 81016213 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 3-(4-methoxyphenyl)-N,2-dimethylbutan-1-amine |
| SMILES | CNCC(C)C(C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H21NO/c1-10(9-14-3)11(2)12-5-7-13(15-4)8-6-12/h5-8,10-11,14H,9H2,1-4H3 |
| InChIKey | XXOBUYRTJAPHHG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |