C9H7F6N — CID 133094723
2-ethyl-4,6-bis(trifluoromethyl)pyridine (PubChem CID 133094723) has the molecular formula C9H7F6N and a molecular weight of 243.15 g/mol. Its IUPAC name is 2-ethyl-4,6-bis(trifluoromethyl)pyridine.
| Compound Name | 2-ethyl-4,6-bis(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 133094723 |
| Molecular Formula | C9H7F6N |
| Molecular Weight | 243.15 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-ethyl-4,6-bis(trifluoromethyl)pyridine |
| SMILES | CCc1cc(C(F)(F)F)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H7F6N/c1-2-6-3-5(8(10,11)12)4-7(16-6)9(13,14)15/h3-4H,2H2,1H3 |
| InChIKey | OHNGHJDMMOZEHB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.15 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |