About methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane
methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane (PubChem CID 163799716) has the molecular formula C9H9F3IN
and a molecular weight of 315.08 g/mol. Its IUPAC name is methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane.
Molecular Properties
| Compound Name | methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane |
| PubChem CID | 163799716 |
| Molecular Formula | C9H9F3IN |
| Molecular Weight | 315.08 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane |
| SMILES | C=ICc1cc(C(F)(F)F)cc(C)n1 |
| InChI | InChI=1S/C9H9F3IN/c1-6-3-7(9(10,11)12)4-8(14-6)5-13-2/h3-4H,2,5H2,1H3 |
| InChIKey | NDXLQBPFKUSORF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.08 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane?
The IUPAC name of methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane (CID 163799716) is methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane.
What is the SMILES notation for methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane?
The canonical SMILES for methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane is C=ICc1cc(C(F)(F)F)cc(C)n1.
What is the InChIKey of methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane?
The InChIKey is NDXLQBPFKUSORF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3IN/c1-6-3-7(9(10,11)12)4-8(14-6)5-13-2/h3-4H,2,5H2,1H3.
What are the key properties of methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane?
methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane has a molecular weight of 315.08 g/mol, XLogP of 3.31, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylidene-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]-λ3-iodane is sourced from PubChem (CID 163799716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).