C8H2F9N — CID 14937918
2,4,6-tris(trifluoromethyl)pyridine (PubChem CID 14937918) has the molecular formula C8H2F9N and a molecular weight of 283.09 g/mol. Its IUPAC name is 2,4,6-tris(trifluoromethyl)pyridine.
| Compound Name | 2,4,6-tris(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 14937918 |
| Molecular Formula | C8H2F9N |
| Molecular Weight | 283.09 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 2,4,6-tris(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H2F9N/c9-6(10,11)3-1-4(7(12,13)14)18-5(2-3)8(15,16)17/h1-2H |
| InChIKey | IBFSYNGWWJIFII-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.09 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |