C11H7F6N — CID 147296051
4-(1-methylcycloprop-2-en-1-yl)-2,6-bis(trifluoromethyl)pyridine (PubChem CID 147296051) has the molecular formula C11H7F6N and a molecular weight of 267.17 g/mol. Its IUPAC name is 4-(1-methylcycloprop-2-en-1-yl)-2,6-bis(trifluoromethyl)pyridine.
| Compound Name | 4-(1-methylcycloprop-2-en-1-yl)-2,6-bis(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 147296051 |
| Molecular Formula | C11H7F6N |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 4-(1-methylcycloprop-2-en-1-yl)-2,6-bis(trifluoromethyl)pyridine |
| SMILES | CC1(c2cc(C(F)(F)F)nc(C(F)(F)F)c2)C=C1 |
| InChI | InChI=1S/C11H7F6N/c1-9(2-3-9)6-4-7(10(12,13)14)18-8(5-6)11(15,16)17/h2-5H,1H3 |
| InChIKey | CVDINOOLMRDWLB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|