C11H10F6N2 — CID 162523537
2-[2,6-bis(trifluoromethyl)-4-pyridinyl]acetonitrile;ethane (PubChem CID 162523537) has the molecular formula C11H10F6N2 and a molecular weight of 284.20 g/mol. Its IUPAC name is 2-[2,6-bis(trifluoromethyl)-4-pyridinyl]acetonitrile;ethane.
| Compound Name | 2-[2,6-bis(trifluoromethyl)-4-pyridinyl]acetonitrile;ethane |
|---|---|
| PubChem CID | 162523537 |
| Molecular Formula | C11H10F6N2 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-[2,6-bis(trifluoromethyl)-4-pyridinyl]acetonitrile;ethane |
| SMILES | CC.N#CCc1cc(C(F)(F)F)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H4F6N2.C2H6/c10-8(11,12)6-3-5(1-2-16)4-7(17-6)9(13,14)15;1-2/h3-4H,1H2;1-2H3 |
| InChIKey | QCJRFHLVVKXPIZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |