C13H8F6N2 — CID 119008310
6-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]pyridin-2-amine (PubChem CID 119008310) has the molecular formula C13H8F6N2 and a molecular weight of 306.21 g/mol. Its IUPAC name is 6-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]pyridin-2-amine.
| Compound Name | 6-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 119008310 |
| Molecular Formula | C13H8F6N2 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 6-(trifluoromethyl)-4-[4-(trifluoromethyl)phenyl]pyridin-2-amine |
| SMILES | Nc1cc(-c2ccc(C(F)(F)F)cc2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H8F6N2/c14-12(15,16)9-3-1-7(2-4-9)8-5-10(13(17,18)19)21-11(20)6-8/h1-6H,(H2,20,21) |
| InChIKey | YLPDEZZSWJHNHU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |