C11H7ClF3N3 — CID 66521037
2-chloro-6-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 66521037) has the molecular formula C11H7ClF3N3 and a molecular weight of 273.65 g/mol. Its IUPAC name is 2-chloro-6-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-6-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 66521037 |
| Molecular Formula | C11H7ClF3N3 |
| Molecular Weight | 273.65 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-chloro-6-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | Nc1cc(-c2ccc(C(F)(F)F)cc2)nc(Cl)n1 |
| InChI | InChI=1S/C11H7ClF3N3/c12-10-17-8(5-9(16)18-10)6-1-3-7(4-2-6)11(13,14)15/h1-5H,(H2,16,17,18) |
| InChIKey | RQLKYVJTCUTUIH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.65 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |