C13H9F5N2S — CID 102716571
6-[4-(difluoromethylsulfanyl)phenyl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102716571) has the molecular formula C13H9F5N2S and a molecular weight of 320.29 g/mol. Its IUPAC name is 6-[4-(difluoromethylsulfanyl)phenyl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-[4-(difluoromethylsulfanyl)phenyl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102716571 |
| Molecular Formula | C13H9F5N2S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 6-[4-(difluoromethylsulfanyl)phenyl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1cc(C(F)(F)F)cc(-c2ccc(SC(F)F)cc2)n1 |
| InChI | InChI=1S/C13H9F5N2S/c14-12(15)21-9-3-1-7(2-4-9)10-5-8(13(16,17)18)6-11(19)20-10/h1-6,12H,(H2,19,20) |
| InChIKey | UCHLEJIKLLZFNI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |