C15H13F3N2O — CID 102716909
6-(4-cyclopropyloxyphenyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102716909) has the molecular formula C15H13F3N2O and a molecular weight of 294.28 g/mol. Its IUPAC name is 6-(4-cyclopropyloxyphenyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(4-cyclopropyloxyphenyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102716909 |
| Molecular Formula | C15H13F3N2O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 6-(4-cyclopropyloxyphenyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1cc(C(F)(F)F)cc(-c2ccc(OC3CC3)cc2)n1 |
| InChI | InChI=1S/C15H13F3N2O/c16-15(17,18)10-7-13(20-14(19)8-10)9-1-3-11(4-2-9)21-12-5-6-12/h1-4,7-8,12H,5-6H2,(H2,19,20) |
| InChIKey | DBLSHODISMBRHR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |