C15H12F3NOS — CID 106522136
6-(4-cyclopropyloxyphenyl)-4-(trifluoromethyl)-1H-pyridine-2-thione (PubChem CID 106522136) has the molecular formula C15H12F3NOS and a molecular weight of 311.33 g/mol. Its IUPAC name is 6-(4-cyclopropyloxyphenyl)-4-(trifluoromethyl)-1H-pyridine-2-thione.
| Compound Name | 6-(4-cyclopropyloxyphenyl)-4-(trifluoromethyl)-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 106522136 |
| Molecular Formula | C15H12F3NOS |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 6-(4-cyclopropyloxyphenyl)-4-(trifluoromethyl)-1H-pyridine-2-thione |
| SMILES | FC(F)(F)c1cc(-c2ccc(OC3CC3)cc2)[nH]c(=S)c1 |
| InChI | InChI=1S/C15H12F3NOS/c16-15(17,18)10-7-13(19-14(21)8-10)9-1-3-11(4-2-9)20-12-5-6-12/h1-4,7-8,12H,5-6H2,(H,19,21) |
| InChIKey | HJNBLUMDOMYVLD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|