C14H12F3NO2S — CID 106514338
6-(3,4-dimethoxyphenyl)-4-(trifluoromethyl)-1H-pyridine-2-thione (PubChem CID 106514338) has the molecular formula C14H12F3NO2S and a molecular weight of 315.32 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-4-(trifluoromethyl)-1H-pyridine-2-thione.
| Compound Name | 6-(3,4-dimethoxyphenyl)-4-(trifluoromethyl)-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 106514338 |
| Molecular Formula | C14H12F3NO2S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-4-(trifluoromethyl)-1H-pyridine-2-thione |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)cc(=S)[nH]2)cc1OC |
| InChI | InChI=1S/C14H12F3NO2S/c1-19-11-4-3-8(5-12(11)20-2)10-6-9(14(15,16)17)7-13(21)18-10/h3-7H,1-2H3,(H,18,21) |
| InChIKey | AGFCEVNKNWIZKC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|