C12H7F5N2S2 — CID 106776709
6-[4-(difluoromethylsulfanyl)phenyl]-2-(trifluoromethyl)-1H-pyrimidine-4-thione (PubChem CID 106776709) has the molecular formula C12H7F5N2S2 and a molecular weight of 338.33 g/mol. Its IUPAC name is 6-[4-(difluoromethylsulfanyl)phenyl]-2-(trifluoromethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-[4-(difluoromethylsulfanyl)phenyl]-2-(trifluoromethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106776709 |
| Molecular Formula | C12H7F5N2S2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 6-[4-(difluoromethylsulfanyl)phenyl]-2-(trifluoromethyl)-1H-pyrimidine-4-thione |
| SMILES | FC(F)Sc1ccc(-c2cc(=S)nc(C(F)(F)F)[nH]2)cc1 |
| InChI | InChI=1S/C12H7F5N2S2/c13-11(14)21-7-3-1-6(2-4-7)8-5-9(20)19-10(18-8)12(15,16)17/h1-5,11H,(H,18,19,20) |
| InChIKey | DVGQMIOODCQJOG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|