C10H8F2N2OS — CID 117357277
3-[4-(difluoromethylsulfanyl)phenyl]-1,2-oxazol-5-amine (PubChem CID 117357277) has the molecular formula C10H8F2N2OS and a molecular weight of 242.25 g/mol. Its IUPAC name is 3-[4-(difluoromethylsulfanyl)phenyl]-1,2-oxazol-5-amine.
| Compound Name | 3-[4-(difluoromethylsulfanyl)phenyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117357277 |
| Molecular Formula | C10H8F2N2OS |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 3-[4-(difluoromethylsulfanyl)phenyl]-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2ccc(SC(F)F)cc2)no1 |
| InChI | InChI=1S/C10H8F2N2OS/c11-10(12)16-7-3-1-6(2-4-7)8-5-9(13)15-14-8/h1-5,10H,13H2 |
| InChIKey | KNRSDSNOJIKJFP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |