C13H13N3O — CID 159562874
3-phenyl-1,2-oxazol-5-amine;1H-pyrrole (PubChem CID 159562874) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 3-phenyl-1,2-oxazol-5-amine;1H-pyrrole.
| Compound Name | 3-phenyl-1,2-oxazol-5-amine;1H-pyrrole |
|---|---|
| PubChem CID | 159562874 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-phenyl-1,2-oxazol-5-amine;1H-pyrrole |
| SMILES | Nc1cc(-c2ccccc2)no1.c1cc[nH]c1 |
| InChI | InChI=1S/C9H8N2O.C4H5N/c10-9-6-8(11-12-9)7-4-2-1-3-5-7;1-2-4-5-3-1/h1-6H,10H2;1-5H |
| InChIKey | MGVLSQYTKBGJHH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |