C9H7ClN2O — CID 3382841
3-(3-chlorophenyl)-1,2-oxazol-5-amine (PubChem CID 3382841) has the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(3-chlorophenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 3382841 |
| Molecular Formula | C9H7ClN2O |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 3-(3-chlorophenyl)-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C9H7ClN2O/c10-7-3-1-2-6(4-7)8-5-9(11)13-12-8/h1-5H,11H2 |
| InChIKey | LSTPIZJDZXGQFB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |