C9H8ClN3O — CID 130439181
4-(3-chlorophenyl)-1,2-oxazole-3,5-diamine (PubChem CID 130439181) has the molecular formula C9H8ClN3O and a molecular weight of 209.64 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-1,2-oxazole-3,5-diamine.
| Compound Name | 4-(3-chlorophenyl)-1,2-oxazole-3,5-diamine |
|---|---|
| PubChem CID | 130439181 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 4-(3-chlorophenyl)-1,2-oxazole-3,5-diamine |
| SMILES | Nc1noc(N)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H8ClN3O/c10-6-3-1-2-5(4-6)7-8(11)13-14-9(7)12/h1-4H,12H2,(H2,11,13) |
| InChIKey | GWSPDTLPQCBDEF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |