C16H15ClN2OS — CID 43335624
4-(3-chlorophenyl)-3-(3-thiophen-2-ylpropyl)-1,2-oxazol-5-amine (PubChem CID 43335624) has the molecular formula C16H15ClN2OS and a molecular weight of 318.83 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3-(3-thiophen-2-ylpropyl)-1,2-oxazol-5-amine.
| Compound Name | 4-(3-chlorophenyl)-3-(3-thiophen-2-ylpropyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 43335624 |
| Molecular Formula | C16H15ClN2OS |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 4-(3-chlorophenyl)-3-(3-thiophen-2-ylpropyl)-1,2-oxazol-5-amine |
| SMILES | Nc1onc(CCCc2cccs2)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15ClN2OS/c17-12-5-1-4-11(10-12)15-14(19-20-16(15)18)8-2-6-13-7-3-9-21-13/h1,3-5,7,9-10H,2,6,8,18H2 |
| InChIKey | HXHMQPJPNOEHEV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |