C15H22N2OS — CID 65428658
3-octyl-4-thiophen-2-yl-1,2-oxazol-5-amine (PubChem CID 65428658) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 3-octyl-4-thiophen-2-yl-1,2-oxazol-5-amine.
| Compound Name | 3-octyl-4-thiophen-2-yl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 65428658 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 3-octyl-4-thiophen-2-yl-1,2-oxazol-5-amine |
| SMILES | CCCCCCCCc1noc(N)c1-c1cccs1 |
| InChI | InChI=1S/C15H22N2OS/c1-2-3-4-5-6-7-9-12-14(15(16)18-17-12)13-10-8-11-19-13/h8,10-11H,2-7,9,16H2,1H3 |
| InChIKey | PAMFAVSDZMJNAK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|