C16H20N2O3 — CID 114753024
4-(1,3-benzodioxol-5-yl)-3-hexyl-1,2-oxazol-5-amine (PubChem CID 114753024) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-3-hexyl-1,2-oxazol-5-amine.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-3-hexyl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 114753024 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-3-hexyl-1,2-oxazol-5-amine |
| SMILES | CCCCCCc1noc(N)c1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H20N2O3/c1-2-3-4-5-6-12-15(16(17)21-18-12)11-7-8-13-14(9-11)20-10-19-13/h7-9H,2-6,10,17H2,1H3 |
| InChIKey | GOKUBIOEKQMKKP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|