C15H19FN2O — CID 114753015
4-(4-fluorophenyl)-3-hexyl-1,2-oxazol-5-amine (PubChem CID 114753015) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3-hexyl-1,2-oxazol-5-amine.
| Compound Name | 4-(4-fluorophenyl)-3-hexyl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 114753015 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-(4-fluorophenyl)-3-hexyl-1,2-oxazol-5-amine |
| SMILES | CCCCCCc1noc(N)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN2O/c1-2-3-4-5-6-13-14(15(17)19-18-13)11-7-9-12(16)10-8-11/h7-10H,2-6,17H2,1H3 |
| InChIKey | CGYOLLCFHKBGOI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|