C17H25N3O — CID 80522271
3-nonyl-4-pyridin-2-yl-1,2-oxazol-5-amine (PubChem CID 80522271) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-nonyl-4-pyridin-2-yl-1,2-oxazol-5-amine.
| Compound Name | 3-nonyl-4-pyridin-2-yl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 80522271 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 3-nonyl-4-pyridin-2-yl-1,2-oxazol-5-amine |
| SMILES | CCCCCCCCCc1noc(N)c1-c1ccccn1 |
| InChI | InChI=1S/C17H25N3O/c1-2-3-4-5-6-7-8-12-15-16(17(18)21-20-15)14-11-9-10-13-19-14/h9-11,13H,2-8,12,18H2,1H3 |
| InChIKey | PRUZAQAIZDOZHC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|