C15H19ClN2O2 — CID 43336106
4-(5-chloro-2-methoxyphenyl)-3-pentyl-1,2-oxazol-5-amine (PubChem CID 43336106) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is 4-(5-chloro-2-methoxyphenyl)-3-pentyl-1,2-oxazol-5-amine.
| Compound Name | 4-(5-chloro-2-methoxyphenyl)-3-pentyl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 43336106 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 4-(5-chloro-2-methoxyphenyl)-3-pentyl-1,2-oxazol-5-amine |
| SMILES | CCCCCc1noc(N)c1-c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C15H19ClN2O2/c1-3-4-5-6-12-14(15(17)20-18-12)11-9-10(16)7-8-13(11)19-2/h7-9H,3-6,17H2,1-2H3 |
| InChIKey | PLIKTPZANIBIIT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|