C12H13FN2O2 — CID 82083559
3-ethyl-4-(5-fluoro-2-methoxyphenyl)-1,2-oxazol-5-amine (PubChem CID 82083559) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is 3-ethyl-4-(5-fluoro-2-methoxyphenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-ethyl-4-(5-fluoro-2-methoxyphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 82083559 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-ethyl-4-(5-fluoro-2-methoxyphenyl)-1,2-oxazol-5-amine |
| SMILES | CCc1noc(N)c1-c1cc(F)ccc1OC |
| InChI | InChI=1S/C12H13FN2O2/c1-3-9-11(12(14)17-15-9)8-6-7(13)4-5-10(8)16-2/h4-6H,3,14H2,1-2H3 |
| InChIKey | IABINTACMZMNGG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |