C11H10FNO2 — CID 116868898
5-(5-fluoro-2-methoxyphenyl)-3-methyl-1,2-oxazole (PubChem CID 116868898) has the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. Its IUPAC name is 5-(5-fluoro-2-methoxyphenyl)-3-methyl-1,2-oxazole.
| Compound Name | 5-(5-fluoro-2-methoxyphenyl)-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 116868898 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 5-(5-fluoro-2-methoxyphenyl)-3-methyl-1,2-oxazole |
| SMILES | COc1ccc(F)cc1-c1cc(C)no1 |
| InChI | InChI=1S/C11H10FNO2/c1-7-5-11(15-13-7)9-6-8(12)3-4-10(9)14-2/h3-6H,1-2H3 |
| InChIKey | KXWGPKGCYRXFAK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |