C11H11FN2O2 — CID 82472973
[5-(5-fluoro-2-methoxyphenyl)-1,2-oxazol-3-yl]methanamine (PubChem CID 82472973) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is [5-(5-fluoro-2-methoxyphenyl)-1,2-oxazol-3-yl]methanamine.
| Compound Name | [5-(5-fluoro-2-methoxyphenyl)-1,2-oxazol-3-yl]methanamine |
|---|---|
| PubChem CID | 82472973 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | [5-(5-fluoro-2-methoxyphenyl)-1,2-oxazol-3-yl]methanamine |
| SMILES | COc1ccc(F)cc1-c1cc(CN)no1 |
| InChI | InChI=1S/C11H11FN2O2/c1-15-10-3-2-7(12)4-9(10)11-5-8(6-13)14-16-11/h2-5H,6,13H2,1H3 |
| InChIKey | JPOYWUGTLPIRIZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |