C12H10FNO3 — CID 82129338
1-[5-(5-fluoro-2-methoxyphenyl)-1,2-oxazol-3-yl]ethanone (PubChem CID 82129338) has the molecular formula C12H10FNO3 and a molecular weight of 235.21 g/mol. Its IUPAC name is 1-[5-(5-fluoro-2-methoxyphenyl)-1,2-oxazol-3-yl]ethanone.
| Compound Name | 1-[5-(5-fluoro-2-methoxyphenyl)-1,2-oxazol-3-yl]ethanone |
|---|---|
| PubChem CID | 82129338 |
| Molecular Formula | C12H10FNO3 |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 1-[5-(5-fluoro-2-methoxyphenyl)-1,2-oxazol-3-yl]ethanone |
| SMILES | COc1ccc(F)cc1-c1cc(C(C)=O)no1 |
| InChI | InChI=1S/C12H10FNO3/c1-7(15)10-6-12(17-14-10)9-5-8(13)3-4-11(9)16-2/h3-6H,1-2H3 |
| InChIKey | LFUZIXKRZYQDCU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |