C15H19NO3 — CID 82049731
[5-(5-tert-butyl-2-methoxyphenyl)-1,2-oxazol-3-yl]methanol (PubChem CID 82049731) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is [5-(5-tert-butyl-2-methoxyphenyl)-1,2-oxazol-3-yl]methanol.
| Compound Name | [5-(5-tert-butyl-2-methoxyphenyl)-1,2-oxazol-3-yl]methanol |
|---|---|
| PubChem CID | 82049731 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | [5-(5-tert-butyl-2-methoxyphenyl)-1,2-oxazol-3-yl]methanol |
| SMILES | COc1ccc(C(C)(C)C)cc1-c1cc(CO)no1 |
| InChI | InChI=1S/C15H19NO3/c1-15(2,3)10-5-6-13(18-4)12(7-10)14-8-11(9-17)16-19-14/h5-8,17H,9H2,1-4H3 |
| InChIKey | QNVVMRXBEPPRNT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |