C14H18N2O2 — CID 82365983
4-(5-tert-butyl-2-methoxyphenyl)-1,2-oxazol-5-amine (PubChem CID 82365983) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-(5-tert-butyl-2-methoxyphenyl)-1,2-oxazol-5-amine.
| Compound Name | 4-(5-tert-butyl-2-methoxyphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 82365983 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 4-(5-tert-butyl-2-methoxyphenyl)-1,2-oxazol-5-amine |
| SMILES | COc1ccc(C(C)(C)C)cc1-c1cnoc1N |
| InChI | InChI=1S/C14H18N2O2/c1-14(2,3)9-5-6-12(17-4)10(7-9)11-8-16-18-13(11)15/h5-8H,15H2,1-4H3 |
| InChIKey | WBAKANZNJPVTHU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |