C12H12F2N2O3 — CID 117428577
4-[2-(difluoromethyl)-4,5-dimethoxyphenyl]-1,2-oxazol-5-amine (PubChem CID 117428577) has the molecular formula C12H12F2N2O3 and a molecular weight of 270.24 g/mol. Its IUPAC name is 4-[2-(difluoromethyl)-4,5-dimethoxyphenyl]-1,2-oxazol-5-amine.
| Compound Name | 4-[2-(difluoromethyl)-4,5-dimethoxyphenyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117428577 |
| Molecular Formula | C12H12F2N2O3 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 4-[2-(difluoromethyl)-4,5-dimethoxyphenyl]-1,2-oxazol-5-amine |
| SMILES | COc1cc(-c2cnoc2N)c(C(F)F)cc1OC |
| InChI | InChI=1S/C12H12F2N2O3/c1-17-9-3-6(8-5-16-19-12(8)15)7(11(13)14)4-10(9)18-2/h3-5,11H,15H2,1-2H3 |
| InChIKey | VCNHZQYGCDQKJS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |