C15H20N2O3 — CID 117442637
4-(4-tert-butyl-2,5-dimethoxyphenyl)-1,2-oxazol-5-amine (PubChem CID 117442637) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-(4-tert-butyl-2,5-dimethoxyphenyl)-1,2-oxazol-5-amine.
| Compound Name | 4-(4-tert-butyl-2,5-dimethoxyphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117442637 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 4-(4-tert-butyl-2,5-dimethoxyphenyl)-1,2-oxazol-5-amine |
| SMILES | COc1cc(C(C)(C)C)c(OC)cc1-c1cnoc1N |
| InChI | InChI=1S/C15H20N2O3/c1-15(2,3)11-7-12(18-4)9(6-13(11)19-5)10-8-17-20-14(10)16/h6-8H,16H2,1-5H3 |
| InChIKey | IEXIWPMUEYIWKX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |