C18H23NO3 — CID 54187127
3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine (PubChem CID 54187127) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine.
| Compound Name | 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine |
|---|---|
| PubChem CID | 54187127 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine |
| SMILES | COc1ccncc1-c1cc(OC)c(C(C)(C)C)cc1OC |
| InChI | InChI=1S/C18H23NO3/c1-18(2,3)14-10-16(21-5)12(9-17(14)22-6)13-11-19-8-7-15(13)20-4/h7-11H,1-6H3 |
| InChIKey | PFVVIEBJXFFDHB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |