About 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine
3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine (PubChem CID 54187127) has the molecular formula C18H23NO3
and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine.
Molecular Properties
| Compound Name | 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine |
| PubChem CID | 54187127 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine |
| SMILES | COc1ccncc1-c1cc(OC)c(C(C)(C)C)cc1OC |
| InChI | InChI=1S/C18H23NO3/c1-18(2,3)14-10-16(21-5)12(9-17(14)22-6)13-11-19-8-7-15(13)20-4/h7-11H,1-6H3 |
| InChIKey | PFVVIEBJXFFDHB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine?
The IUPAC name of 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine (CID 54187127) is 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine.
What is the SMILES notation for 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine?
The canonical SMILES for 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine is COc1ccncc1-c1cc(OC)c(C(C)(C)C)cc1OC.
What is the InChIKey of 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine?
The InChIKey is PFVVIEBJXFFDHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO3/c1-18(2,3)14-10-16(21-5)12(9-17(14)22-6)13-11-19-8-7-15(13)20-4/h7-11H,1-6H3.
What are the key properties of 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine?
3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine has a molecular weight of 301.39 g/mol, XLogP of 4.07, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-tert-butyl-2,5-dimethoxyphenyl)-4-methoxypyridine is sourced from PubChem (CID 54187127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).