C21H30N2O2 — CID 70157537
4-[amino-(4-methoxy-3-pyridinyl)methyl]-3,5-ditert-butylphenol (PubChem CID 70157537) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 4-[amino-(4-methoxy-3-pyridinyl)methyl]-3,5-ditert-butylphenol.
| Compound Name | 4-[amino-(4-methoxy-3-pyridinyl)methyl]-3,5-ditert-butylphenol |
|---|---|
| PubChem CID | 70157537 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 4-[amino-(4-methoxy-3-pyridinyl)methyl]-3,5-ditert-butylphenol |
| SMILES | COc1ccncc1C(N)c1c(C(C)(C)C)cc(O)cc1C(C)(C)C |
| InChI | InChI=1S/C21H30N2O2/c1-20(2,3)15-10-13(24)11-16(21(4,5)6)18(15)19(22)14-12-23-9-8-17(14)25-7/h8-12,19,24H,22H2,1-7H3 |
| InChIKey | BRRQPJWAJGRBQW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |