C11H13N3O — CID 166436066
3-(1,3-dimethylpyrazol-4-yl)-4-methoxypyridine (PubChem CID 166436066) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-(1,3-dimethylpyrazol-4-yl)-4-methoxypyridine.
| Compound Name | 3-(1,3-dimethylpyrazol-4-yl)-4-methoxypyridine |
|---|---|
| PubChem CID | 166436066 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 3-(1,3-dimethylpyrazol-4-yl)-4-methoxypyridine |
| SMILES | COc1ccncc1-c1cn(C)nc1C |
| InChI | InChI=1S/C11H13N3O/c1-8-10(7-14(2)13-8)9-6-12-5-4-11(9)15-3/h4-7H,1-3H3 |
| InChIKey | AYJFIALUUHIPOY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |