C11H11ClN2O3 — CID 117389663
4-(2-chloro-4,5-dimethoxyphenyl)-1,2-oxazol-5-amine (PubChem CID 117389663) has the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. Its IUPAC name is 4-(2-chloro-4,5-dimethoxyphenyl)-1,2-oxazol-5-amine.
| Compound Name | 4-(2-chloro-4,5-dimethoxyphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117389663 |
| Molecular Formula | C11H11ClN2O3 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 4-(2-chloro-4,5-dimethoxyphenyl)-1,2-oxazol-5-amine |
| SMILES | COc1cc(Cl)c(-c2cnoc2N)cc1OC |
| InChI | InChI=1S/C11H11ClN2O3/c1-15-9-3-6(7-5-14-17-11(7)13)8(12)4-10(9)16-2/h3-5H,13H2,1-2H3 |
| InChIKey | CXSMOLJDKFDITP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |