C11H11ClN2O2 — CID 117349779
4-(3-chloro-6-methoxy-2-methylphenyl)-1,2-oxazol-5-amine (PubChem CID 117349779) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is 4-(3-chloro-6-methoxy-2-methylphenyl)-1,2-oxazol-5-amine.
| Compound Name | 4-(3-chloro-6-methoxy-2-methylphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117349779 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 4-(3-chloro-6-methoxy-2-methylphenyl)-1,2-oxazol-5-amine |
| SMILES | COc1ccc(Cl)c(C)c1-c1cnoc1N |
| InChI | InChI=1S/C11H11ClN2O2/c1-6-8(12)3-4-9(15-2)10(6)7-5-14-16-11(7)13/h3-5H,13H2,1-2H3 |
| InChIKey | PAURQSWQWQSYDJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |