C12H14N2O5S — CID 117480762
4-(3,6-dimethoxy-2-methylsulfonylphenyl)-1,2-oxazol-5-amine (PubChem CID 117480762) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-(3,6-dimethoxy-2-methylsulfonylphenyl)-1,2-oxazol-5-amine.
| Compound Name | 4-(3,6-dimethoxy-2-methylsulfonylphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117480762 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-(3,6-dimethoxy-2-methylsulfonylphenyl)-1,2-oxazol-5-amine |
| SMILES | COc1ccc(OC)c(S(C)(=O)=O)c1-c1cnoc1N |
| InChI | InChI=1S/C12H14N2O5S/c1-17-8-4-5-9(18-2)11(20(3,15)16)10(8)7-6-14-19-12(7)13/h4-6H,13H2,1-3H3 |
| InChIKey | CCZKBTLGFYHSEB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |