C10H9ClN2O3S — CID 117434464
4-(2-chloro-6-methylsulfonylphenyl)-1,2-oxazol-5-amine (PubChem CID 117434464) has the molecular formula C10H9ClN2O3S and a molecular weight of 272.71 g/mol. Its IUPAC name is 4-(2-chloro-6-methylsulfonylphenyl)-1,2-oxazol-5-amine.
| Compound Name | 4-(2-chloro-6-methylsulfonylphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117434464 |
| Molecular Formula | C10H9ClN2O3S |
| Molecular Weight | 272.71 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 4-(2-chloro-6-methylsulfonylphenyl)-1,2-oxazol-5-amine |
| SMILES | CS(=O)(=O)c1cccc(Cl)c1-c1cnoc1N |
| InChI | InChI=1S/C10H9ClN2O3S/c1-17(14,15)8-4-2-3-7(11)9(8)6-5-13-16-10(6)12/h2-5H,12H2,1H3 |
| InChIKey | WYJOYPUOKJDDAW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.71 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |