C11H10ClN3O3 — CID 117422595
N-[2-(5-amino-1,2-oxazol-4-yl)-3-chloro-6-hydroxyphenyl]acetamide (PubChem CID 117422595) has the molecular formula C11H10ClN3O3 and a molecular weight of 267.67 g/mol. Its IUPAC name is N-[2-(5-amino-1,2-oxazol-4-yl)-3-chloro-6-hydroxyphenyl]acetamide.
| Compound Name | N-[2-(5-amino-1,2-oxazol-4-yl)-3-chloro-6-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 117422595 |
| Molecular Formula | C11H10ClN3O3 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | N-[2-(5-amino-1,2-oxazol-4-yl)-3-chloro-6-hydroxyphenyl]acetamide |
| SMILES | CC(=O)Nc1c(O)ccc(Cl)c1-c1cnoc1N |
| InChI | InChI=1S/C11H10ClN3O3/c1-5(16)15-10-8(17)3-2-7(12)9(10)6-4-14-18-11(6)13/h2-4,17H,13H2,1H3,(H,15,16) |
| InChIKey | ZHRIQYHANGSIDO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|