C9H9Cl2NO4S — CID 117479727
(2-acetamido-6-chloro-3-hydroxyphenyl)methanesulfonyl chloride (PubChem CID 117479727) has the molecular formula C9H9Cl2NO4S and a molecular weight of 298.15 g/mol. Its IUPAC name is (2-acetamido-6-chloro-3-hydroxyphenyl)methanesulfonyl chloride.
| Compound Name | (2-acetamido-6-chloro-3-hydroxyphenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 117479727 |
| Molecular Formula | C9H9Cl2NO4S |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | (2-acetamido-6-chloro-3-hydroxyphenyl)methanesulfonyl chloride |
| SMILES | CC(=O)Nc1c(O)ccc(Cl)c1CS(=O)(=O)Cl |
| InChI | InChI=1S/C9H9Cl2NO4S/c1-5(13)12-9-6(4-17(11,15)16)7(10)2-3-8(9)14/h2-3,14H,4H2,1H3,(H,12,13) |
| InChIKey | OIFSEFRUDZHVMG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|