C7H5Cl3O3S — CID 84810750
(2,6-dichloro-4-hydroxyphenyl)methanesulfonyl chloride (PubChem CID 84810750) has the molecular formula C7H5Cl3O3S and a molecular weight of 275.54 g/mol. Its IUPAC name is (2,6-dichloro-4-hydroxyphenyl)methanesulfonyl chloride.
| Compound Name | (2,6-dichloro-4-hydroxyphenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 84810750 |
| Molecular Formula | C7H5Cl3O3S |
| Molecular Weight | 275.54 g/mol |
| Exact Mass | 273.90 |
| IUPAC Name | (2,6-dichloro-4-hydroxyphenyl)methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)Cc1c(Cl)cc(O)cc1Cl |
| InChI | InChI=1S/C7H5Cl3O3S/c8-6-1-4(11)2-7(9)5(6)3-14(10,12)13/h1-2,11H,3H2 |
| InChIKey | TTYKLLCAOFKDTI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |